C23H29ClN8O3S2 — CID 87507978
4-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 87507978) has the molecular formula C23H29ClN8O3S2 and a molecular weight of 565.13 g/mol. Its IUPAC name is 4-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | 4-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87507978 |
| Molecular Formula | C23H29ClN8O3S2 |
| Molecular Weight | 565.13 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 4-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CC[C@H](NC(=S)C(=O)Nc2ccc(Cl)nn2)[C@H](C2c3sc(C(N)=O)nc3CCN2C)C1 |
| InChI | InChI=1S/C23H29ClN8O3S2/c1-31(2)23(35)11-4-5-13(26-21(36)20(34)28-16-7-6-15(24)29-30-16)12(10-11)17-18-14(8-9-32(17)3)27-22(37-18)19(25)33/h6-7,11-13,17H,4-5,8-10H2,1-3H3,(H2,25,33)(H,26,36)(H,28,30,34)/t11-,12+,13-,17?/m0/s1 |
| InChIKey | VCOJKPWTVARPJR-BORQHUKESA-N |
| XLogP | 1.64 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.13 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|