About methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid
methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid (PubChem CID 87508063) has the molecular formula C19H20N4O6
and a molecular weight of 400.39 g/mol. Its IUPAC name is methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid.
Molecular Properties
| Compound Name | methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid |
| PubChem CID | 87508063 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid |
| SMILES | COc1cc(-n2nncc2-c2cccc(N(OC)C(=O)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N4O6/c1-26-16-9-14(10-17(27-2)18(16)28-3)22-15(11-20-21-22)12-6-5-7-13(8-12)23(29-4)19(24)25/h5-11H,1-4H3,(H,24,25) |
| InChIKey | HBUMMQRDOXNJKG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid?
The IUPAC name of methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid (CID 87508063) is methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid.
What is the SMILES notation for methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid?
The canonical SMILES for methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid is COc1cc(-n2nncc2-c2cccc(N(OC)C(=O)O)c2)cc(OC)c1OC.
What is the InChIKey of methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid?
The InChIKey is HBUMMQRDOXNJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O6/c1-26-16-9-14(10-17(27-2)18(16)28-3)22-15(11-20-21-22)12-6-5-7-13(8-12)23(29-4)19(24)25/h5-11H,1-4H3,(H,24,25).
What are the key properties of methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid?
methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid has a molecular weight of 400.39 g/mol, XLogP of 3.01, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-[3-[3-(3,4,5-trimethoxyphenyl)triazol-4-yl]phenyl]carbamic acid is sourced from PubChem (CID 87508063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).