About azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide
azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 87509141) has the molecular formula C6H15Cl2N3
and a molecular weight of 200.11 g/mol. Its IUPAC name is azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide |
| PubChem CID | 87509141 |
| Molecular Formula | C6H15Cl2N3 |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C(CCl)CCl.N |
| InChI | InChI=1S/C6H12Cl2N2.H3N/c1-10(2)5-9-6(3-7)4-8;/h5-6H,3-4H2,1-2H3;1H3/b9-5+; |
| InChIKey | APNAQOBPDGLMOS-SZKNIZGXSA-N |
| XLogP | 1.58 |
| TPSA | 50.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide?
The IUPAC name of azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide (CID 87509141) is azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide.
What is the SMILES notation for azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide?
The canonical SMILES for azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide is CN(C)/C=N/C(CCl)CCl.N.
What is the InChIKey of azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide?
The InChIKey is APNAQOBPDGLMOS-SZKNIZGXSA-N. The full InChI is InChI=1S/C6H12Cl2N2.H3N/c1-10(2)5-9-6(3-7)4-8;/h5-6H,3-4H2,1-2H3;1H3/b9-5+;.
What are the key properties of azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide?
azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide has a molecular weight of 200.11 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N'-(1,3-dichloropropan-2-yl)-N,N-dimethylmethanimidamide is sourced from PubChem (CID 87509141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).