C27H30Cl2N4O2S — CID 87509399
1-[3-[2-(2,4-dichlorophenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-[(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea (PubChem CID 87509399) has the molecular formula C27H30Cl2N4O2S and a molecular weight of 545.54 g/mol. Its IUPAC name is 1-[3-[2-(2,4-dichlorophenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-[(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea.
| Compound Name | 1-[3-[2-(2,4-dichlorophenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-[(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 87509399 |
| Molecular Formula | C27H30Cl2N4O2S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 1-[3-[2-(2,4-dichlorophenyl)ethyl]-2,4-dioxo-1H-quinazolin-7-yl]-3-[(1R,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea |
| SMILES | C[C@H]1[C@@H](NC(=S)Nc2ccc3c(=O)n(CCc4ccc(Cl)cc4Cl)c(=O)[nH]c3c2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C27H30Cl2N4O2S/c1-14-20-10-16(27(20,2)3)11-22(14)31-25(36)30-18-6-7-19-23(13-18)32-26(35)33(24(19)34)9-8-15-4-5-17(28)12-21(15)29/h4-7,12-14,16,20,22H,8-11H2,1-3H3,(H,32,35)(H2,30,31,36)/t14-,16+,20-,22+/m1/s1 |
| InChIKey | MVDLQUQTSVGZBF-JEYQKGAJSA-N |
| XLogP | 5.60 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|