C20H23FO6S — CID 87509627
2-[(2S,3R,4R,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-4-methylbenzenesulfonic acid (PubChem CID 87509627) has the molecular formula C20H23FO6S and a molecular weight of 410.46 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[(2S,3R,4R,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87509627 |
| Molecular Formula | C20H23FO6S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-4-methylbenzenesulfonic acid |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@H](F)[C@@H]1c1cc(C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C20H23FO6S/c1-13-8-9-17(28(22,23)24)15(10-13)18-19(21)16(27-20(18)25-2)12-26-11-14-6-4-3-5-7-14/h3-10,16,18-20H,11-12H2,1-2H3,(H,22,23,24)/t16-,18+,19+,20+/m1/s1 |
| InChIKey | MAHBJBBLDOEIHL-GTAWCEEGSA-N |
| XLogP | 3.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|