C32H46O4S2 — CID 87509763
2,4-bis[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-3-ene-1,1,2,3-tetrol (PubChem CID 87509763) has the molecular formula C32H46O4S2 and a molecular weight of 558.85 g/mol. Its IUPAC name is 2,4-bis[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-3-ene-1,1,2,3-tetrol.
| Compound Name | 2,4-bis[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-3-ene-1,1,2,3-tetrol |
|---|---|
| PubChem CID | 87509763 |
| Molecular Formula | C32H46O4S2 |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 2,4-bis[(2,6-ditert-butylthiopyran-4-ylidene)methyl]cyclobut-3-ene-1,1,2,3-tetrol |
| SMILES | CC(C)(C)C1=CC(=CC2=C(O)C(O)(C=C3C=C(C(C)(C)C)SC(C(C)(C)C)=C3)C2(O)O)C=C(C(C)(C)C)S1 |
| InChI | InChI=1S/C32H46O4S2/c1-27(2,3)22-14-19(15-23(37-22)28(4,5)6)13-21-26(33)31(34,32(21,35)36)18-20-16-24(29(7,8)9)38-25(17-20)30(10,11)12/h13-18,33-36H,1-12H3 |
| InChIKey | FJJLTRGFENNTFB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|