About (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol
(2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 87509915) has the molecular formula C13H26F3NO
and a molecular weight of 269.35 g/mol. Its IUPAC name is (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 87509915 |
| Molecular Formula | C13H26F3NO |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCCCN(CCCCC)C[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C13H26F3NO/c1-3-5-7-9-17(10-8-6-4-2)11-12(18)13(14,15)16/h12,18H,3-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | NTVPESPEALBMLB-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol (CID 87509915) is (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol is CCCCCN(CCCCC)C[C@@H](O)C(F)(F)F.
What is the InChIKey of (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol?
The InChIKey is NTVPESPEALBMLB-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H26F3NO/c1-3-5-7-9-17(10-8-6-4-2)11-12(18)13(14,15)16/h12,18H,3-11H2,1-2H3/t12-/m1/s1.
What are the key properties of (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol?
(2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol has a molecular weight of 269.35 g/mol, XLogP of 3.59, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(dipentylamino)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 87509915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).