C8H14O — CID 87509936
(3R,5E)-octa-1,5-dien-3-ol (PubChem CID 87509936) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (3R,5E)-octa-1,5-dien-3-ol.
| Compound Name | (3R,5E)-octa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 87509936 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (3R,5E)-octa-1,5-dien-3-ol |
| SMILES | CC/C=C/C[C@H](C=C)O |
| InChI | InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h4-6,8-9H,2-3,7H2,1H3/b6-5+/t8-/m0/s1 |
| InChIKey | APFBWMGEGSELQP-GJIOHYHPSA-N |
| XLogP | 2.00 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | 94 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|