About 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane
1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane (PubChem CID 87509955) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane |
| PubChem CID | 87509955 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane |
| SMILES | C=COC(C)(C)C.CC(C)CC=COC=CC(C)(C)C |
| InChI | InChI=1S/C12H22O.C6H12O/c1-11(2)7-6-9-13-10-8-12(3,4)5;1-5-7-6(2,3)4/h6,8-11H,7H2,1-5H3;5H,1H2,2-4H3 |
| InChIKey | XXEQLVNHXBHHBU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane?
The IUPAC name of 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane (CID 87509955) is 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane.
What is the SMILES notation for 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane?
The canonical SMILES for 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane is C=COC(C)(C)C.CC(C)CC=COC=CC(C)(C)C.
What is the InChIKey of 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane?
The InChIKey is XXEQLVNHXBHHBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.C6H12O/c1-11(2)7-6-9-13-10-8-12(3,4)5;1-5-7-6(2,3)4/h6,8-11H,7H2,1-5H3;5H,1H2,2-4H3.
What are the key properties of 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane?
1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane has a molecular weight of 282.47 g/mol, XLogP of 6.07, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbut-1-enoxy)-4-methylpent-1-ene;2-ethenoxy-2-methylpropane is sourced from PubChem (CID 87509955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).