C18H15NO4 — CID 87510200
8-methyl-6H-isoquinolino[2,1-b]isoquinoline-2,3,10,11-tetrol (PubChem CID 87510200) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 8-methyl-6H-isoquinolino[2,1-b]isoquinoline-2,3,10,11-tetrol.
| Compound Name | 8-methyl-6H-isoquinolino[2,1-b]isoquinoline-2,3,10,11-tetrol |
|---|---|
| PubChem CID | 87510200 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 8-methyl-6H-isoquinolino[2,1-b]isoquinoline-2,3,10,11-tetrol |
| SMILES | CC1=c2cc(O)c(O)cc2=CC2=c3cc(O)c(O)cc3=CCN12 |
| InChI | InChI=1S/C18H15NO4/c1-9-12-7-17(22)16(21)6-11(12)4-14-13-8-18(23)15(20)5-10(13)2-3-19(9)14/h2,4-8,20-23H,3H2,1H3 |
| InChIKey | CEUOALDKAJKWSS-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|