C50H55N2O2P2+ — CID 87510440
[8-[7-bis(3,5-dimethylphenyl)phosphanyl-3,4-dihydro-2H-1,4-benzoxazin-8-yl]-4,4-dimethyl-2,3-dihydro-1,4-benzoxazin-4-ium-7-yl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 87510440) has the molecular formula C50H55N2O2P2+ and a molecular weight of 777.95 g/mol. Its IUPAC name is [8-[7-bis(3,5-dimethylphenyl)phosphanyl-3,4-dihydro-2H-1,4-benzoxazin-8-yl]-4,4-dimethyl-2,3-dihydro-1,4-benzoxazin-4-ium-7-yl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [8-[7-bis(3,5-dimethylphenyl)phosphanyl-3,4-dihydro-2H-1,4-benzoxazin-8-yl]-4,4-dimethyl-2,3-dihydro-1,4-benzoxazin-4-ium-7-yl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 87510440 |
| Molecular Formula | C50H55N2O2P2+ |
| Molecular Weight | 777.95 g/mol |
| Exact Mass | 777.37 |
| IUPAC Name | [8-[7-bis(3,5-dimethylphenyl)phosphanyl-3,4-dihydro-2H-1,4-benzoxazin-8-yl]-4,4-dimethyl-2,3-dihydro-1,4-benzoxazin-4-ium-7-yl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)c2ccc3c(c2-c2c(P(c4cc(C)cc(C)c4)c4cc(C)cc(C)c4)ccc4c2OCC[N+]4(C)C)OCCN3)c1 |
| InChI | InChI=1S/C50H55N2O2P2/c1-31-19-32(2)24-39(23-31)55(40-25-33(3)20-34(4)26-40)45-13-11-43-49(53-17-15-51-43)47(45)48-46(14-12-44-50(48)54-18-16-52(44,9)10)56(41-27-35(5)21-36(6)28-41)42-29-37(7)22-38(8)30-42/h11-14,19-30,51H,15-18H2,1-10H3/q+1 |
| InChIKey | NWYLXSGVOCDDGX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.95 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|