C31H33N5O4 — CID 87510449
formyl 1-[[4-[3-[3-(ethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]phenyl]methyl]-3-methylpiperidine-3-carboxylate (PubChem CID 87510449) has the molecular formula C31H33N5O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is formyl 1-[[4-[3-[3-(ethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]phenyl]methyl]-3-methylpiperidine-3-carboxylate.
| Compound Name | formyl 1-[[4-[3-[3-(ethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]phenyl]methyl]-3-methylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 87510449 |
| Molecular Formula | C31H33N5O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | formyl 1-[[4-[3-[3-(ethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]phenyl]methyl]-3-methylpiperidine-3-carboxylate |
| SMILES | CCNC(=O)Nc1cccc(-c2cnc3cc(-c4ccc(CN5CCCC(C)(C(=O)OC=O)C5)cc4)ccn23)c1 |
| InChI | InChI=1S/C31H33N5O4/c1-3-32-30(39)34-26-7-4-6-25(16-26)27-18-33-28-17-24(12-15-36(27)28)23-10-8-22(9-11-23)19-35-14-5-13-31(2,20-35)29(38)40-21-37/h4,6-12,15-18,21H,3,5,13-14,19-20H2,1-2H3,(H2,32,34,39) |
| InChIKey | FDCHPZRLFACQEI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|