C72H99O3P — CID 87510713
phosphorous acid;1,2,3,4-tetrakis(2,4-ditert-butyl-5-methylphenyl)biphenylene (PubChem CID 87510713) has the molecular formula C72H99O3P and a molecular weight of 1043.55 g/mol. Its IUPAC name is phosphorous acid;1,2,3,4-tetrakis(2,4-ditert-butyl-5-methylphenyl)biphenylene.
| Compound Name | phosphorous acid;1,2,3,4-tetrakis(2,4-ditert-butyl-5-methylphenyl)biphenylene |
|---|---|
| PubChem CID | 87510713 |
| Molecular Formula | C72H99O3P |
| Molecular Weight | 1043.55 g/mol |
| Exact Mass | 1042.73 |
| IUPAC Name | phosphorous acid;1,2,3,4-tetrakis(2,4-ditert-butyl-5-methylphenyl)biphenylene |
| SMILES | Cc1cc(-c2c3c(c(-c4cc(C)c(C(C)(C)C)cc4C(C)(C)C)c(-c4cc(C)c(C(C)(C)C)cc4C(C)(C)C)c2-c2cc(C)c(C(C)(C)C)cc2C(C)(C)C)-c2ccccc2-3)c(C(C)(C)C)cc1C(C)(C)C.OP(O)O |
| InChI | InChI=1S/C72H96.H3O3P/c1-41-33-47(55(69(17,18)19)37-51(41)65(5,6)7)61-59-45-31-29-30-32-46(45)60(59)62(48-34-42(2)52(66(8,9)10)38-56(48)70(20,21)22)64(50-36-44(4)54(68(14,15)16)40-58(50)72(26,27)28)63(61)49-35-43(3)53(67(11,12)13)39-57(49)71(23,24)25;1-4(2)3/h29-40H,1-28H3;1-3H |
| InChIKey | JRALAMNNUJKFQR-UHFFFAOYSA-N |
| XLogP | 20.81 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.55 |
| LogP ≤ 5 | 20.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|