About (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride
(2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride (PubChem CID 87510835) has the molecular formula C17H16ClF4NO2
and a molecular weight of 377.77 g/mol. Its IUPAC name is (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride |
| PubChem CID | 87510835 |
| Molecular Formula | C17H16ClF4NO2 |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride |
| SMILES | Cl.Fc1cccc(-c2c(F)cc(F)c(OC[C@@H]3CNCCO3)c2F)c1 |
| InChI | InChI=1S/C17H15F4NO2.ClH/c18-11-3-1-2-10(6-11)15-13(19)7-14(20)17(16(15)21)24-9-12-8-22-4-5-23-12;/h1-3,6-7,12,22H,4-5,8-9H2;1H/t12-;/m0./s1 |
| InChIKey | FGTBLJMXDHSCTQ-YDALLXLXSA-N |
| XLogP | 3.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride?
The IUPAC name of (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride (CID 87510835) is (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride.
What is the SMILES notation for (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride?
The canonical SMILES for (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride is Cl.Fc1cccc(-c2c(F)cc(F)c(OC[C@@H]3CNCCO3)c2F)c1.
What is the InChIKey of (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride?
The InChIKey is FGTBLJMXDHSCTQ-YDALLXLXSA-N. The full InChI is InChI=1S/C17H15F4NO2.ClH/c18-11-3-1-2-10(6-11)15-13(19)7-14(20)17(16(15)21)24-9-12-8-22-4-5-23-12;/h1-3,6-7,12,22H,4-5,8-9H2;1H/t12-;/m0./s1.
What are the key properties of (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride?
(2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride has a molecular weight of 377.77 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[2,4,6-trifluoro-3-(3-fluorophenyl)phenoxy]methyl]morpholine;hydrochloride is sourced from PubChem (CID 87510835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).