About N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide
N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide (PubChem CID 87511554) has the molecular formula C7H9N3OS
and a molecular weight of 183.24 g/mol. Its IUPAC name is N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide |
| PubChem CID | 87511554 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide |
| SMILES | CN(CC#N)C(=O)N1C=CSC1 |
| InChI | InChI=1S/C7H9N3OS/c1-9(3-2-8)7(11)10-4-5-12-6-10/h4-5H,3,6H2,1H3 |
| InChIKey | NOAVIAHTTPYEEE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide?
The IUPAC name of N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide (CID 87511554) is N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide.
What is the SMILES notation for N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide?
The canonical SMILES for N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide is CN(CC#N)C(=O)N1C=CSC1.
What is the InChIKey of N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide?
The InChIKey is NOAVIAHTTPYEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3OS/c1-9(3-2-8)7(11)10-4-5-12-6-10/h4-5H,3,6H2,1H3.
What are the key properties of N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide?
N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide has a molecular weight of 183.24 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N-methyl-2H-1,3-thiazole-3-carboxamide is sourced from PubChem (CID 87511554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).