C21H19F3N4O5 — CID 87511612
(2,2,2-trifluoroacetyl) 3-[(2-amino-4-pyridinyl)methyl]-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate (PubChem CID 87511612) has the molecular formula C21H19F3N4O5 and a molecular weight of 464.40 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[(2-amino-4-pyridinyl)methyl]-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[(2-amino-4-pyridinyl)methyl]-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 87511612 |
| Molecular Formula | C21H19F3N4O5 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[(2-amino-4-pyridinyl)methyl]-4-oxo-1-[[(1R)-1-phenylethyl]carbamoyl]azetidine-2-carboxylate |
| SMILES | C[C@@H](NC(=O)N1C(=O)C(Cc2ccnc(N)c2)C1C(=O)OC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H19F3N4O5/c1-11(13-5-3-2-4-6-13)27-20(32)28-16(18(30)33-19(31)21(22,23)24)14(17(28)29)9-12-7-8-26-15(25)10-12/h2-8,10-11,14,16H,9H2,1H3,(H2,25,26)(H,27,32)/t11-,14?,16?/m1/s1 |
| InChIKey | SHCJVXQKZCENAX-OLQXHTCTSA-N |
| XLogP | 2.14 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|