About 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide
2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide (PubChem CID 87512110) has the molecular formula C26H28BrN3O
and a molecular weight of 478.43 g/mol. Its IUPAC name is 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide.
Molecular Properties
| Compound Name | 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide |
| PubChem CID | 87512110 |
| Molecular Formula | C26H28BrN3O |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide |
| SMILES | CC(=O)C[n+]1ccn(C2CCC(C(C#N)(c3ccccc3)c3ccccc3)C2)c1C.[Br-] |
| InChI | InChI=1S/C26H28N3O.BrH/c1-20(30)18-28-15-16-29(21(28)2)25-14-13-24(17-25)26(19-27,22-9-5-3-6-10-22)23-11-7-4-8-12-23;/h3-12,15-16,24-25H,13-14,17-18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MALDDULNYAUVII-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 49.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide?
The IUPAC name of 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide (CID 87512110) is 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide.
What is the SMILES notation for 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide?
The canonical SMILES for 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide is CC(=O)C[n+]1ccn(C2CCC(C(C#N)(c3ccccc3)c3ccccc3)C2)c1C.[Br-].
What is the InChIKey of 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide?
The InChIKey is MALDDULNYAUVII-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H28N3O.BrH/c1-20(30)18-28-15-16-29(21(28)2)25-14-13-24(17-25)26(19-27,22-9-5-3-6-10-22)23-11-7-4-8-12-23;/h3-12,15-16,24-25H,13-14,17-18H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide?
2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide has a molecular weight of 478.43 g/mol, XLogP of 1.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-methyl-3-(2-oxopropyl)imidazol-3-ium-1-yl]cyclopentyl]-2,2-diphenylacetonitrile bromide is sourced from PubChem (CID 87512110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).