C24H26Cl2N6O8S2 — CID 87512350
(5S)-5-[[6-(4-chlorophenyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione;[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride (PubChem CID 87512350) has the molecular formula C24H26Cl2N6O8S2 and a molecular weight of 661.55 g/mol. Its IUPAC name is (5S)-5-[[6-(4-chlorophenyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione;[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride.
| Compound Name | (5S)-5-[[6-(4-chlorophenyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione;[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 87512350 |
| Molecular Formula | C24H26Cl2N6O8S2 |
| Molecular Weight | 661.55 g/mol |
| Exact Mass | 660.06 |
| IUPAC Name | (5S)-5-[[6-(4-chlorophenyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione;[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfonyl chloride |
| SMILES | C[C@]1(CS(=O)(=O)Cl)NC(=O)NC1=O.C[C@]1(CS(=O)(=O)N2CCc3cc(-c4ccc(Cl)cc4)ncc3C2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H19ClN4O4S.C5H7ClN2O4S/c1-19(17(25)22-18(26)23-19)11-29(27,28)24-7-6-13-8-16(21-9-14(13)10-24)12-2-4-15(20)5-3-12;1-5(2-13(6,11)12)3(9)7-4(10)8-5/h2-5,8-9H,6-7,10-11H2,1H3,(H2,22,23,25,26);2H2,1H3,(H2,7,8,9,10)/t19-;5-/m11/s1 |
| InChIKey | ARDXHQVFYKQTSD-CDVFAHIUSA-N |
| XLogP | 0.84 |
| TPSA | 200.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.55 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|