About 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+)
2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) (PubChem CID 87512404) has the molecular formula C9H10N2Ru
and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+).
Molecular Properties
| Compound Name | 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) |
| PubChem CID | 87512404 |
| Molecular Formula | C9H10N2Ru |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) |
| SMILES | Cc1ccc[n-]1.[Ru+2].c1cc[n-]c1 |
| InChI | InChI=1S/C5H6N.C4H4N.Ru/c1-5-3-2-4-6-5;1-2-4-5-3-1;/h2-4H,1H3;1-4H;/q2*-1;+2 |
| InChIKey | WATMQDCLSVXUFB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+)?
The IUPAC name of 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) (CID 87512404) is 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+).
What is the SMILES notation for 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+)?
The canonical SMILES for 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) is Cc1ccc[n-]1.[Ru+2].c1cc[n-]c1.
What is the InChIKey of 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+)?
The InChIKey is WATMQDCLSVXUFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N.C4H4N.Ru/c1-5-3-2-4-6-5;1-2-4-5-3-1;/h2-4H,1H3;1-4H;/q2*-1;+2.
What are the key properties of 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+)?
2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) has a molecular weight of 247.26 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrrol-1-ide;pyrrol-1-ide;ruthenium(2+) is sourced from PubChem (CID 87512404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).