C33H43N5O7S — CID 87512682
(2R)-2-[[4-[4-[2-[(8Z)-8-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxyimino]-6,7-dihydro-5H-naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid (PubChem CID 87512682) has the molecular formula C33H43N5O7S and a molecular weight of 653.80 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[2-[(8Z)-8-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxyimino]-6,7-dihydro-5H-naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[[4-[4-[2-[(8Z)-8-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxyimino]-6,7-dihydro-5H-naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 87512682 |
| Molecular Formula | C33H43N5O7S |
| Molecular Weight | 653.80 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | (2R)-2-[[4-[4-[2-[(8Z)-8-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxyimino]-6,7-dihydro-5H-naphthalen-2-yl]ethynyl]phenyl]piperazin-1-yl]sulfonylamino]propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)N1CCN(c2ccc(C#Cc3ccc4c(c3)/C(=N\OCCNCC(=O)OC(C)(C)C)CCC4)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C33H43N5O7S/c1-24(32(40)41)36-46(42,43)38-19-17-37(18-20-38)28-14-11-25(12-15-28)8-9-26-10-13-27-6-5-7-30(29(27)22-26)35-44-21-16-34-23-31(39)45-33(2,3)4/h10-15,22,24,34,36H,5-7,16-21,23H2,1-4H3,(H,40,41)/b35-30-/t24-/m1/s1 |
| InChIKey | NSLAADKRDMUJKR-XAUNVLFDSA-N |
| XLogP | 2.50 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.80 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|