C27H34BrN3O2 — CID 87512745
2-[(1R,3S)-3-[3-(2-ethoxyethyl)-2-methylimidazol-1-ium-1-yl]cyclopentyl]-2,2-diphenylacetamide bromide (PubChem CID 87512745) has the molecular formula C27H34BrN3O2 and a molecular weight of 512.49 g/mol. Its IUPAC name is 2-[(1R,3S)-3-[3-(2-ethoxyethyl)-2-methylimidazol-1-ium-1-yl]cyclopentyl]-2,2-diphenylacetamide bromide.
| Compound Name | 2-[(1R,3S)-3-[3-(2-ethoxyethyl)-2-methylimidazol-1-ium-1-yl]cyclopentyl]-2,2-diphenylacetamide bromide |
|---|---|
| PubChem CID | 87512745 |
| Molecular Formula | C27H34BrN3O2 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 2-[(1R,3S)-3-[3-(2-ethoxyethyl)-2-methylimidazol-1-ium-1-yl]cyclopentyl]-2,2-diphenylacetamide bromide |
| SMILES | CCOCCn1cc[n+]([C@H]2CC[C@@H](C(C(N)=O)(c3ccccc3)c3ccccc3)C2)c1C.[Br-] |
| InChI | InChI=1S/C27H33N3O2.BrH/c1-3-32-19-18-29-16-17-30(21(29)2)25-15-14-24(20-25)27(26(28)31,22-10-6-4-7-11-22)23-12-8-5-9-13-23;/h4-13,16-17,24-25H,3,14-15,18-20H2,1-2H3,(H-,28,31);1H/t24-,25+;/m1./s1 |
| InChIKey | NHSOPKVUUVAZKQ-KGQXAQPSSA-N |
| XLogP | 0.94 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|