C16H21NO3 — CID 87512927
(2S,3R)-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methyl-3-phenyloxirane-2-carboxamide (PubChem CID 87512927) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2S,3R)-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methyl-3-phenyloxirane-2-carboxamide.
| Compound Name | (2S,3R)-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methyl-3-phenyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 87512927 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2S,3R)-N-[(1S,2S)-2-hydroxycyclohexyl]-N-methyl-3-phenyloxirane-2-carboxamide |
| SMILES | CN(C(=O)[C@H]1O[C@@H]1c1ccccc1)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H21NO3/c1-17(12-9-5-6-10-13(12)18)16(19)15-14(20-15)11-7-3-2-4-8-11/h2-4,7-8,12-15,18H,5-6,9-10H2,1H3/t12-,13-,14+,15-/m0/s1 |
| InChIKey | CPWNZKDDSCEEHM-XQLPTFJDSA-N |
| XLogP | 1.89 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|