C29H48O4Si — CID 87513005
methyl (5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoate (PubChem CID 87513005) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is methyl (5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoate.
| Compound Name | methyl (5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 87513005 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | methyl (5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoate |
| SMILES | CC/C=C/CC(/C=C/C=C/C/C=C/C/C=C/C=C/C(O)CCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H48O4Si/c1-8-9-18-22-27(33-34(6,7)29(2,3)4)23-20-17-15-13-11-10-12-14-16-19-21-26(30)24-25-28(31)32-5/h9-11,14-21,23,26-27,30H,8,12-13,22,24-25H2,1-7H3/b11-10+,16-14+,17-15+,18-9+,21-19+,23-20+ |
| InChIKey | HKJVUGOWGCHXFO-HQGUTWFHSA-N |
| XLogP | 7.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|