C11H13O7P — CID 87513141
2-[ethoxycarbonyloxy(hydroxy)phosphoryl]-2-phenylacetic acid (PubChem CID 87513141) has the molecular formula C11H13O7P and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-[ethoxycarbonyloxy(hydroxy)phosphoryl]-2-phenylacetic acid.
| Compound Name | 2-[ethoxycarbonyloxy(hydroxy)phosphoryl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 87513141 |
| Molecular Formula | C11H13O7P |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[ethoxycarbonyloxy(hydroxy)phosphoryl]-2-phenylacetic acid |
| SMILES | CCOC(=O)OP(=O)(O)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H13O7P/c1-2-17-11(14)18-19(15,16)9(10(12)13)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | HZJKKFCBNYNUHJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|