C28H46O4Si — CID 87513303
(5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid (PubChem CID 87513303) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid.
| Compound Name | (5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid |
|---|---|
| PubChem CID | 87513303 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (5E,7E,10E,13E,15E,19E)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid |
| SMILES | CC/C=C/CC(/C=C/C=C/C/C=C/C/C=C/C=C/C(O)CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H46O4Si/c1-7-8-17-21-26(32-33(5,6)28(2,3)4)22-19-16-14-12-10-9-11-13-15-18-20-25(29)23-24-27(30)31/h8-10,13-20,22,25-26,29H,7,11-12,21,23-24H2,1-6H3,(H,30,31)/b10-9+,15-13+,16-14+,17-8+,20-18+,22-19+ |
| InChIKey | NXTOZGQUEKQMHR-XHCMWSPJSA-N |
| XLogP | 7.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|