C13H17NRu — CID 87513530
cyclopenta-1,3-diene;ruthenium(2+);1,3,4,5-tetramethyl-2H-pyrrol-2-ide (PubChem CID 87513530) has the molecular formula C13H17NRu and a molecular weight of 288.36 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ruthenium(2+);1,3,4,5-tetramethyl-2H-pyrrol-2-ide.
| Compound Name | cyclopenta-1,3-diene;ruthenium(2+);1,3,4,5-tetramethyl-2H-pyrrol-2-ide |
|---|---|
| PubChem CID | 87513530 |
| Molecular Formula | C13H17NRu |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | cyclopenta-1,3-diene;ruthenium(2+);1,3,4,5-tetramethyl-2H-pyrrol-2-ide |
| SMILES | Cc1[c-]n(C)c(C)c1C.[C-]1=CC=CC1.[Ru+2] |
| InChI | InChI=1S/C8H12N.C5H5.Ru/c1-6-5-9(4)8(3)7(6)2;1-2-4-5-3-1;/h1-4H3;1-3H,4H2;/q2*-1;+2 |
| InChIKey | AZPDNCULYOPQOB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|