C19H13ClF4N4O2 — CID 87513625
2-chloro-6-[[(2R)-1-(1,3-dioxoisoindol-2-yl)-5,5,5-trifluoropentan-2-yl]amino]-5-fluoropyridine-3-carbonitrile (PubChem CID 87513625) has the molecular formula C19H13ClF4N4O2 and a molecular weight of 440.78 g/mol. Its IUPAC name is 2-chloro-6-[[(2R)-1-(1,3-dioxoisoindol-2-yl)-5,5,5-trifluoropentan-2-yl]amino]-5-fluoropyridine-3-carbonitrile.
| Compound Name | 2-chloro-6-[[(2R)-1-(1,3-dioxoisoindol-2-yl)-5,5,5-trifluoropentan-2-yl]amino]-5-fluoropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 87513625 |
| Molecular Formula | C19H13ClF4N4O2 |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-chloro-6-[[(2R)-1-(1,3-dioxoisoindol-2-yl)-5,5,5-trifluoropentan-2-yl]amino]-5-fluoropyridine-3-carbonitrile |
| SMILES | N#Cc1cc(F)c(N[C@H](CCC(F)(F)F)CN2C(=O)c3ccccc3C2=O)nc1Cl |
| InChI | InChI=1S/C19H13ClF4N4O2/c20-15-10(8-25)7-14(21)16(27-15)26-11(5-6-19(22,23)24)9-28-17(29)12-3-1-2-4-13(12)18(28)30/h1-4,7,11H,5-6,9H2,(H,26,27)/t11-/m1/s1 |
| InChIKey | QNVAZKYIGKZFAV-LLVKDONJSA-N |
| XLogP | 4.16 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|