About 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine
1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine (PubChem CID 87513727) has the molecular formula C17H39NO5P2
and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine.
Molecular Properties
| Compound Name | 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine |
| PubChem CID | 87513727 |
| Molecular Formula | C17H39NO5P2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine |
| SMILES | CCC(N)OC(C)(C(C)PC(C)(OC)OC)C(C)PC(C)(OC)OC |
| InChI | InChI=1S/C17H39NO5P2/c1-11-14(18)23-15(4,12(2)24-16(5,19-7)20-8)13(3)25-17(6,21-9)22-10/h12-14,24-25H,11,18H2,1-10H3 |
| InChIKey | XQHHHIJIXQIAEC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine?
The IUPAC name of 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine (CID 87513727) is 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine.
What is the SMILES notation for 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine?
The canonical SMILES for 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine is CCC(N)OC(C)(C(C)PC(C)(OC)OC)C(C)PC(C)(OC)OC.
What is the InChIKey of 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine?
The InChIKey is XQHHHIJIXQIAEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H39NO5P2/c1-11-14(18)23-15(4,12(2)24-16(5,19-7)20-8)13(3)25-17(6,21-9)22-10/h12-14,24-25H,11,18H2,1-10H3.
What are the key properties of 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine?
1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine has a molecular weight of 399.45 g/mol, XLogP of 3.52, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-bis(1,1-dimethoxyethylphosphanyl)-3-methylpentan-3-yl]oxypropan-1-amine is sourced from PubChem (CID 87513727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).