About 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine
1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine (PubChem CID 87513922) has the molecular formula C9H10ClFN6
and a molecular weight of 256.67 g/mol. Its IUPAC name is 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine |
| PubChem CID | 87513922 |
| Molecular Formula | C9H10ClFN6 |
| Molecular Weight | 256.67 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine |
| SMILES | CN(C)c1cc(N)nn1-c1nc(Cl)ncc1F |
| InChI | InChI=1S/C9H10ClFN6/c1-16(2)7-3-6(12)15-17(7)8-5(11)4-13-9(10)14-8/h3-4H,1-2H3,(H2,12,15) |
| InChIKey | OQYPYRFDXSLGHG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.67 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine?
The IUPAC name of 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine (CID 87513922) is 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine.
What is the SMILES notation for 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine?
The canonical SMILES for 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine is CN(C)c1cc(N)nn1-c1nc(Cl)ncc1F.
What is the InChIKey of 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine?
The InChIKey is OQYPYRFDXSLGHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClFN6/c1-16(2)7-3-6(12)15-17(7)8-5(11)4-13-9(10)14-8/h3-4H,1-2H3,(H2,12,15).
What are the key properties of 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine?
1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine has a molecular weight of 256.67 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-N,5-N-dimethylpyrazole-3,5-diamine is sourced from PubChem (CID 87513922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).