C17H18N2O2S — CID 87514299
N-hydroxy-4-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclopropyl]benzamide (PubChem CID 87514299) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-hydroxy-4-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclopropyl]benzamide.
| Compound Name | N-hydroxy-4-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 87514299 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-hydroxy-4-[1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)cyclopropyl]benzamide |
| SMILES | O=C(NO)c1ccc(C2(c3nc4c(s3)CCCC4)CC2)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c20-15(19-21)11-5-7-12(8-6-11)17(9-10-17)16-18-13-3-1-2-4-14(13)22-16/h5-8,21H,1-4,9-10H2,(H,19,20) |
| InChIKey | WAJUBZXIFVEQKL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|