About 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid
3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid (PubChem CID 87514376) has the molecular formula C10H17N3O4
and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid |
| PubChem CID | 87514376 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid |
| SMILES | N/C(=N/O)C1COC2(CCN(C(=O)O)CC2)C1 |
| InChI | InChI=1S/C10H17N3O4/c11-8(12-16)7-5-10(17-6-7)1-3-13(4-2-10)9(14)15/h7,16H,1-6H2,(H2,11,12)(H,14,15) |
| InChIKey | DFMFOHWMIKNUFX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid?
The IUPAC name of 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid (CID 87514376) is 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid.
What is the SMILES notation for 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid?
The canonical SMILES for 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid is N/C(=N/O)C1COC2(CCN(C(=O)O)CC2)C1.
What is the InChIKey of 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid?
The InChIKey is DFMFOHWMIKNUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4/c11-8(12-16)7-5-10(17-6-7)1-3-13(4-2-10)9(14)15/h7,16H,1-6H2,(H2,11,12)(H,14,15).
What are the key properties of 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid?
3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid has a molecular weight of 243.26 g/mol, XLogP of 0.28, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-N'-hydroxycarbamimidoyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid is sourced from PubChem (CID 87514376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).