About CID 87514520
CID 87514520 (PubChem CID 87514520) has the molecular formula C6H7BN2
and a molecular weight of 117.95 g/mol.
Molecular Properties
| Compound Name | CID 87514520 |
| PubChem CID | 87514520 |
| Molecular Formula | C6H7BN2 |
| Molecular Weight | 117.95 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | — |
| SMILES | [B]c1cc(N)cnc1C |
| InChI | InChI=1S/C6H7BN2/c1-4-6(7)2-5(8)3-9-4/h2-3H,8H2,1H3 |
| InChIKey | XZRPNKDAYOHGKV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.95 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87514520 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87514520?
The IUPAC name of CID 87514520 (CID 87514520) is not available.
What is the SMILES notation for CID 87514520?
The canonical SMILES for CID 87514520 is [B]c1cc(N)cnc1C.
What is the InChIKey of CID 87514520?
The InChIKey is XZRPNKDAYOHGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BN2/c1-4-6(7)2-5(8)3-9-4/h2-3H,8H2,1H3.
What are the key properties of CID 87514520?
CID 87514520 has a molecular weight of 117.95 g/mol, XLogP of -0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87514520 is sourced from PubChem (CID 87514520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).