C35H42N2O3 — CID 87514567
N-[(2S,3R)-4-[(3-ethynylphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-methyl-5-(2-propylpentanoyl)benzamide (PubChem CID 87514567) has the molecular formula C35H42N2O3 and a molecular weight of 538.73 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(3-ethynylphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-methyl-5-(2-propylpentanoyl)benzamide.
| Compound Name | N-[(2S,3R)-4-[(3-ethynylphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-methyl-5-(2-propylpentanoyl)benzamide |
|---|---|
| PubChem CID | 87514567 |
| Molecular Formula | C35H42N2O3 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | N-[(2S,3R)-4-[(3-ethynylphenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-methyl-5-(2-propylpentanoyl)benzamide |
| SMILES | C#Cc1cccc(CNC[C@@H](O)[C@H](Cc2ccccc2)NC(=O)c2cc(C)cc(C(=O)C(CCC)CCC)c2)c1 |
| InChI | InChI=1S/C35H42N2O3/c1-5-12-29(13-6-2)34(39)30-18-25(4)19-31(22-30)35(40)37-32(21-27-14-9-8-10-15-27)33(38)24-36-23-28-17-11-16-26(7-3)20-28/h3,8-11,14-20,22,29,32-33,36,38H,5-6,12-13,21,23-24H2,1-2,4H3,(H,37,40)/t32-,33+/m0/s1 |
| InChIKey | PQWCXWUJOOEBPW-JHOUSYSJSA-N |
| XLogP | 5.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|