About (1S,2S)-1-iodopropane-1,2-diamine
(1S,2S)-1-iodopropane-1,2-diamine (PubChem CID 87514719) has the molecular formula C3H9IN2
and a molecular weight of 200.02 g/mol. Its IUPAC name is (1S,2S)-1-iodopropane-1,2-diamine.
Molecular Properties
| Compound Name | (1S,2S)-1-iodopropane-1,2-diamine |
| PubChem CID | 87514719 |
| Molecular Formula | C3H9IN2 |
| Molecular Weight | 200.02 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (1S,2S)-1-iodopropane-1,2-diamine |
| SMILES | C[C@H](N)[C@@H](N)I |
| InChI | InChI=1S/C3H9IN2/c1-2(5)3(4)6/h2-3H,5-6H2,1H3/t2-,3+/m0/s1 |
| InChIKey | ZSZZRIDVFBOXEW-STHAYSLISA-N |
| XLogP | 0.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.02 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1S,2S)-1-iodopropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1-iodopropane-1,2-diamine?
The IUPAC name of (1S,2S)-1-iodopropane-1,2-diamine (CID 87514719) is (1S,2S)-1-iodopropane-1,2-diamine.
What is the SMILES notation for (1S,2S)-1-iodopropane-1,2-diamine?
The canonical SMILES for (1S,2S)-1-iodopropane-1,2-diamine is C[C@H](N)[C@@H](N)I.
What is the InChIKey of (1S,2S)-1-iodopropane-1,2-diamine?
The InChIKey is ZSZZRIDVFBOXEW-STHAYSLISA-N. The full InChI is InChI=1S/C3H9IN2/c1-2(5)3(4)6/h2-3H,5-6H2,1H3/t2-,3+/m0/s1.
What are the key properties of (1S,2S)-1-iodopropane-1,2-diamine?
(1S,2S)-1-iodopropane-1,2-diamine has a molecular weight of 200.02 g/mol, XLogP of 0.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1-iodopropane-1,2-diamine is sourced from PubChem (CID 87514719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).