C9H13Cl2Ti — CID 87514830
1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(3+);dichloride (PubChem CID 87514830) has the molecular formula C9H13Cl2Ti and a molecular weight of 239.98 g/mol. Its IUPAC name is 1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(3+);dichloride.
| Compound Name | 1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(3+);dichloride |
|---|---|
| PubChem CID | 87514830 |
| Molecular Formula | C9H13Cl2Ti |
| Molecular Weight | 239.98 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(3+);dichloride |
| SMILES | CC1=[C-]C(C)C(C)=C1C.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C9H13.2ClH.Ti/c1-6-5-7(2)9(4)8(6)3;;;/h6H,1-4H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | RMTPTIOSMWLDBE-UHFFFAOYSA-L |
| XLogP | -3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.98 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|