C15H21FN2O — CID 87514918
N-[(5Z,7E)-3-cyano-5-ethenyl-3-ethyl-8-fluoronona-5,7-dienyl]formamide (PubChem CID 87514918) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is N-[(5Z,7E)-3-cyano-5-ethenyl-3-ethyl-8-fluoronona-5,7-dienyl]formamide.
| Compound Name | N-[(5Z,7E)-3-cyano-5-ethenyl-3-ethyl-8-fluoronona-5,7-dienyl]formamide |
|---|---|
| PubChem CID | 87514918 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[(5Z,7E)-3-cyano-5-ethenyl-3-ethyl-8-fluoronona-5,7-dienyl]formamide |
| SMILES | C=C/C(=C\C=C(/C)F)CC(C#N)(CC)CCNC=O |
| InChI | InChI=1S/C15H21FN2O/c1-4-14(7-6-13(3)16)10-15(5-2,11-17)8-9-18-12-19/h4,6-7,12H,1,5,8-10H2,2-3H3,(H,18,19)/b13-6+,14-7+ |
| InChIKey | LXTYTBDXNZFHTR-AANLELRNSA-N |
| XLogP | 3.42 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|