C22H32O4 — CID 87514930
2,3-dihydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid (PubChem CID 87514930) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2,3-dihydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid.
| Compound Name | 2,3-dihydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid |
|---|---|
| PubChem CID | 87514930 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2,3-dihydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(O)C(O)C(=O)O |
| InChI | InChI=1S/C22H32O4/c1-15(11-12-18-17(3)10-7-13-22(18,4)5)8-6-9-16(2)14-19(23)20(24)21(25)26/h6,8-9,11-12,14,19-20,23-24H,7,10,13H2,1-5H3,(H,25,26) |
| InChIKey | NNJIOJLQPOCLEB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|