C15H7BrCl2F3NO — CID 87515012
(E)-1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one (PubChem CID 87515012) has the molecular formula C15H7BrCl2F3NO and a molecular weight of 425.03 g/mol. Its IUPAC name is (E)-1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one.
| Compound Name | (E)-1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one |
|---|---|
| PubChem CID | 87515012 |
| Molecular Formula | C15H7BrCl2F3NO |
| Molecular Weight | 425.03 g/mol |
| Exact Mass | 422.90 |
| IUPAC Name | (E)-1-(6-bromo-3-pyridinyl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one |
| SMILES | O=C(/C=C(\c1cc(Cl)cc(Cl)c1)C(F)(F)F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C15H7BrCl2F3NO/c16-14-2-1-8(7-22-14)13(23)6-12(15(19,20)21)9-3-10(17)5-11(18)4-9/h1-7H/b12-6+ |
| InChIKey | MLSCZQVXLICFAP-WUXMJOGZSA-N |
| XLogP | 5.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.03 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|