About 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate
2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate (PubChem CID 87515035) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate.
Molecular Properties
| Compound Name | 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate |
| PubChem CID | 87515035 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate |
| SMILES | CCCCCCCC(=O)OCCN/C(N)=N/C |
| InChI | InChI=1S/C12H25N3O2/c1-3-4-5-6-7-8-11(16)17-10-9-15-12(13)14-2/h3-10H2,1-2H3,(H3,13,14,15) |
| InChIKey | YQCVDMUVAMCMRP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate?
The IUPAC name of 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate (CID 87515035) is 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate.
What is the SMILES notation for 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate?
The canonical SMILES for 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate is CCCCCCCC(=O)OCCN/C(N)=N/C.
What is the InChIKey of 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate?
The InChIKey is YQCVDMUVAMCMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c1-3-4-5-6-7-8-11(16)17-10-9-15-12(13)14-2/h3-10H2,1-2H3,(H3,13,14,15).
What are the key properties of 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate?
2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate has a molecular weight of 243.35 g/mol, XLogP of 1.42, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N'-methylcarbamimidoyl)amino]ethyl octanoate is sourced from PubChem (CID 87515035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).