About N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane
N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane (PubChem CID 87515555) has the molecular formula C10H24N2O2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane.
Molecular Properties
| Compound Name | N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane |
| PubChem CID | 87515555 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane |
| SMILES | CCC.CCN(CC)CCC(N)=S(=O)=O |
| InChI | InChI=1S/C7H16N2O2S.C3H8/c1-3-9(4-2)6-5-7(8)12(10)11;1-3-2/h3-6,8H2,1-2H3;3H2,1-2H3 |
| InChIKey | HCGTVNDDRFIKMH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane?
The IUPAC name of N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane (CID 87515555) is N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane.
What is the SMILES notation for N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane?
The canonical SMILES for N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane is CCC.CCN(CC)CCC(N)=S(=O)=O.
What is the InChIKey of N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane?
The InChIKey is HCGTVNDDRFIKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2S.C3H8/c1-3-9(4-2)6-5-7(8)12(10)11;1-3-2/h3-6,8H2,1-2H3;3H2,1-2H3.
What are the key properties of N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane?
N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane has a molecular weight of 236.38 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethyl-1-sulfonylpropane-1,3-diamine;propane is sourced from PubChem (CID 87515555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).