C36H41Cl2NO5 — CID 87515648
(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;[(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate (PubChem CID 87515648) has the molecular formula C36H41Cl2NO5 and a molecular weight of 638.63 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;[(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate.
| Compound Name | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;[(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87515648 |
| Molecular Formula | C36H41Cl2NO5 |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 637.24 |
| IUPAC Name | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate;[(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1cccc(Oc2ccccc2)c1.C[C@@H]1C[C@@H](OC(=O)c2cccnc2)CC(C)(C)C1 |
| InChI | InChI=1S/C21H20Cl2O3.C15H21NO2/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15;1-11-7-13(9-15(2,3)8-11)18-14(17)12-5-4-6-16-10-12/h3-12,17,19H,13H2,1-2H3;4-6,10-11,13H,7-9H2,1-3H3/t;11-,13-/m.1/s1 |
| InChIKey | HBOCNJOVSIJEBI-YNOMLHRESA-N |
| XLogP | 9.57 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |