C20H20FN5OS2 — CID 87515658
(5E)-5-[[4-fluoro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 87515658) has the molecular formula C20H20FN5OS2 and a molecular weight of 429.55 g/mol. Its IUPAC name is (5E)-5-[[4-fluoro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-fluoro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87515658 |
| Molecular Formula | C20H20FN5OS2 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (5E)-5-[[4-fluoro-3-[6-(4-methyl-1,4-diazepan-1-yl)pyrazin-2-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1CCCN(c2cncc(-c3cc(/C=C4/SC(=S)NC4=O)ccc3F)n2)CC1 |
| InChI | InChI=1S/C20H20FN5OS2/c1-25-5-2-6-26(8-7-25)18-12-22-11-16(23-18)14-9-13(3-4-15(14)21)10-17-19(27)24-20(28)29-17/h3-4,9-12H,2,5-8H2,1H3,(H,24,27,28)/b17-10+ |
| InChIKey | GLOLIPPVXVFWFF-LICLKQGHSA-N |
| XLogP | 2.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|