C17H17NO2S — CID 87516306
4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanal (PubChem CID 87516306) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanal.
| Compound Name | 4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanal |
|---|---|
| PubChem CID | 87516306 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-oxo-4-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanal |
| SMILES | O=CCCC(=O)N1CCc2sccc2C1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2S/c19-11-4-7-16(20)18-10-8-15-14(9-12-21-15)17(18)13-5-2-1-3-6-13/h1-3,5-6,9,11-12,17H,4,7-8,10H2 |
| InChIKey | QTXASOWOQSFSGF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|