C18H14ClFN4O2 — CID 87516317
(2-chloro-4-pyridinyl)-[2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 87516317) has the molecular formula C18H14ClFN4O2 and a molecular weight of 372.79 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 87516317 |
| Molecular Formula | C18H14ClFN4O2 |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[2-[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCCC1c1nnc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C18H14ClFN4O2/c19-15-10-11(7-8-21-15)18(25)24-9-3-6-14(24)17-23-22-16(26-17)12-4-1-2-5-13(12)20/h1-2,4-5,7-8,10,14H,3,6,9H2 |
| InChIKey | VCSQMFDZLZUKHI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|