About 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde
2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 87516432) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 87516432 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC1=C(C)C(C)=C(C=O)CC1 |
| InChI | InChI=1S/C10H14O/c1-7-4-5-10(6-11)9(3)8(7)2/h6H,4-5H2,1-3H3 |
| InChIKey | TYQBXRJGRHSMPZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde (CID 87516432) is 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde is CC1=C(C)C(C)=C(C=O)CC1.
What is the InChIKey of 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is TYQBXRJGRHSMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-7-4-5-10(6-11)9(3)8(7)2/h6H,4-5H2,1-3H3.
What are the key properties of 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde?
2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 150.22 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethylcyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 87516432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).