About 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol
3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol (PubChem CID 87516518) has the molecular formula C27H24N2O5S
and a molecular weight of 488.57 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol |
| PubChem CID | 87516518 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol |
| SMILES | CCN(CC)c1ccc2c(C(=O)O)c(-c3nc4ccccc4s3)c(=O)oc2c1.Oc1ccccc1 |
| InChI | InChI=1S/C21H18N2O4S.C6H6O/c1-3-23(4-2)12-9-10-13-15(11-12)27-21(26)18(17(13)20(24)25)19-22-14-7-5-6-8-16(14)28-19;7-6-4-2-1-3-5-6/h5-11H,3-4H2,1-2H3,(H,24,25);1-5,7H |
| InChIKey | PSUAUXYIUDMXBF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol?
The IUPAC name of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol (CID 87516518) is 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol?
The canonical SMILES for 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol is CCN(CC)c1ccc2c(C(=O)O)c(-c3nc4ccccc4s3)c(=O)oc2c1.Oc1ccccc1.
What is the InChIKey of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol?
The InChIKey is PSUAUXYIUDMXBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4S.C6H6O/c1-3-23(4-2)12-9-10-13-15(11-12)27-21(26)18(17(13)20(24)25)19-22-14-7-5-6-8-16(14)28-19;7-6-4-2-1-3-5-6/h5-11H,3-4H2,1-2H3,(H,24,25);1-5,7H.
What are the key properties of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol?
3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol has a molecular weight of 488.57 g/mol, XLogP of 6.01, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)-2-oxochromene-4-carboxylic acid;phenol is sourced from PubChem (CID 87516518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).