About 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one
2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one (PubChem CID 87516822) has the molecular formula C12H15ClN2O
and a molecular weight of 238.72 g/mol. Its IUPAC name is 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one |
| PubChem CID | 87516822 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one |
| SMILES | CCN1CC(C)(C)c2nc(Cl)ccc2C1=O |
| InChI | InChI=1S/C12H15ClN2O/c1-4-15-7-12(2,3)10-8(11(15)16)5-6-9(13)14-10/h5-6H,4,7H2,1-3H3 |
| InChIKey | ATGCXSHLRUNHBC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one?
The IUPAC name of 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one (CID 87516822) is 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one.
What is the SMILES notation for 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one?
The canonical SMILES for 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one is CCN1CC(C)(C)c2nc(Cl)ccc2C1=O.
What is the InChIKey of 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one?
The InChIKey is ATGCXSHLRUNHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O/c1-4-15-7-12(2,3)10-8(11(15)16)5-6-9(13)14-10/h5-6H,4,7H2,1-3H3.
What are the key properties of 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one?
2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one has a molecular weight of 238.72 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-ethyl-8,8-dimethyl-7H-1,6-naphthyridin-5-one is sourced from PubChem (CID 87516822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).