About CID 87517130
CID 87517130 (PubChem CID 87517130) has the molecular formula C5H3B2N
and a molecular weight of 98.71 g/mol.
Molecular Properties
| Compound Name | CID 87517130 |
| PubChem CID | 87517130 |
| Molecular Formula | C5H3B2N |
| Molecular Weight | 98.71 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | — |
| SMILES | [B]c1cncc([B])c1 |
| InChI | InChI=1S/C5H3B2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| InChIKey | VJZYQGQAKNGEHV-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.71 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87517130 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87517130?
The IUPAC name of CID 87517130 (CID 87517130) is not available.
What is the SMILES notation for CID 87517130?
The canonical SMILES for CID 87517130 is [B]c1cncc([B])c1.
What is the InChIKey of CID 87517130?
The InChIKey is VJZYQGQAKNGEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3B2N/c6-4-1-5(7)3-8-2-4/h1-3H.
What are the key properties of CID 87517130?
CID 87517130 has a molecular weight of 98.71 g/mol, XLogP of -1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87517130 is sourced from PubChem (CID 87517130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).