C37H37F6N10O5PS2 — CID 87517253
bis[[1-[[2-amino-6-(4-methylphenyl)sulfanylpurin-9-yl]methyl]-2-(2,2,2-trifluoroethyl)cyclopropyl]oxy]methylphosphonic acid (PubChem CID 87517253) has the molecular formula C37H37F6N10O5PS2 and a molecular weight of 910.86 g/mol. Its IUPAC name is bis[[1-[[2-amino-6-(4-methylphenyl)sulfanylpurin-9-yl]methyl]-2-(2,2,2-trifluoroethyl)cyclopropyl]oxy]methylphosphonic acid.
| Compound Name | bis[[1-[[2-amino-6-(4-methylphenyl)sulfanylpurin-9-yl]methyl]-2-(2,2,2-trifluoroethyl)cyclopropyl]oxy]methylphosphonic acid |
|---|---|
| PubChem CID | 87517253 |
| Molecular Formula | C37H37F6N10O5PS2 |
| Molecular Weight | 910.86 g/mol |
| Exact Mass | 910.20 |
| IUPAC Name | bis[[1-[[2-amino-6-(4-methylphenyl)sulfanylpurin-9-yl]methyl]-2-(2,2,2-trifluoroethyl)cyclopropyl]oxy]methylphosphonic acid |
| SMILES | Cc1ccc(Sc2nc(N)nc3c2ncn3CC2(OC(OC3(Cn4cnc5c(Sc6ccc(C)cc6)nc(N)nc54)CC3CC(F)(F)F)P(=O)(O)O)CC2CC(F)(F)F)cc1 |
| InChI | InChI=1S/C37H37F6N10O5PS2/c1-19-3-7-23(8-4-19)60-29-25-27(48-31(44)50-29)52(17-46-25)15-34(11-21(34)13-36(38,39)40)57-33(59(54,55)56)58-35(12-22(35)14-37(41,42)43)16-53-18-47-26-28(53)49-32(45)51-30(26)61-24-9-5-20(2)6-10-24/h3-10,17-18,21-22,33H,11-16H2,1-2H3,(H2,44,48,50)(H2,45,49,51)(H2,54,55,56) |
| InChIKey | SIUVFCNSLNPIFS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 215.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.86 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|