C18H24ClN3O3 — CID 8751751
1-(4-chlorobenzoyl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]piperidine-4-carboxamide (PubChem CID 8751751) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 8751751 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[(2R)-1-(ethylamino)-1-oxopropan-2-yl]piperidine-4-carboxamide |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H24ClN3O3/c1-3-20-16(23)12(2)21-17(24)13-8-10-22(11-9-13)18(25)14-4-6-15(19)7-5-14/h4-7,12-13H,3,8-11H2,1-2H3,(H,20,23)(H,21,24)/t12-/m1/s1 |
| InChIKey | HJPOWUUQBPYSGC-GFCCVEGCSA-N |
| XLogP | 1.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |